CAS 476317-34-7 is the registry number for 2–Bromo–N–(4–(2–pyridinyl)–1,3–thiazol–2–yl)benzamide. Offered by: GLPBio. Available pack sizes: 5mg.
2-bromo-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide (CAS 476317-34-7) is a chemical compound with the molecular formula C15H10BrN3OS and a molecular weight of 360.2 g/mol. IUPAC name: 2-bromo-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide. InChIKey: OGXCZPHWSGKJGK-UHFFFAOYSA-N.
| Molecular formula | C15H10BrN3OS |
|---|---|
| Molecular weight | 360.2 g/mol |
| IUPAC name | 2-bromo-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide |
| InChIKey | OGXCZPHWSGKJGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=NC(=CS2)C3=CC=CC=N3)Br |
Computed by PubChem (NCBI)