Products 3096963-39-9
CAS 3096963-39-9 is the registry number for Boc-[3-(4-carboxyphenyl)-1,2,3-oxadiazol-3-ium-5-yl]amide, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[5-[(2-methylpropan-2-yl)oxycarbonylamino]oxadiazol-3-ium-3-yl]benzoate (CAS 3096963-39-9) is a chemical compound with the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. IUPAC name: 4-[5-[(2-methylpropan-2-yl)oxycarbonylamino]oxadiazol-3-ium-3-yl]benzoate. InChIKey: HSYPDCKRNIURFE-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O5 |
|---|---|
| Molecular weight | 305.29 g/mol |
| IUPAC name | 4-[5-[(2-methylpropan-2-yl)oxycarbonylamino]oxadiazol-3-ium-3-yl]benzoate |
| InChIKey | HSYPDCKRNIURFE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C[N+](=NO1)C2=CC=C(C=C2)C(=O)[O-] |
Computed by PubChem (NCBI)