CAS 31005-72-8 is the registry number for 2,2-Dimethyl-3,4-dihydro-2H-1-benzopyran-7-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2-dimethyl-3,4-dihydrochromen-7-ol (CAS 31005-72-8) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 2,2-dimethyl-3,4-dihydrochromen-7-ol. InChIKey: XKZKBTFRXIAYBM-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 2,2-dimethyl-3,4-dihydrochromen-7-ol |
| InChIKey | XKZKBTFRXIAYBM-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(O1)C=C(C=C2)O)C |
Computed by PubChem (NCBI)