Products 3105839-86-6
CAS 3105839-86-6 is the registry number for N-Fmoc-N-methyl-O-(tetrahydro-2H-pyran-2-yl)-L-threonine, >97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(oxan-2-yloxy)butanoic acid (CAS 3105839-86-6) is a chemical compound with the molecular formula C25H29NO6 and a molecular weight of 439.5 g/mol. IUPAC name: (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(oxan-2-yloxy)butanoic acid. InChIKey: XSGIFDKIGNNXSD-MHOZMEHISA-N.
| Molecular formula | C25H29NO6 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(oxan-2-yloxy)butanoic acid |
| InChIKey | XSGIFDKIGNNXSD-MHOZMEHISA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC4CCCCO4 |
Computed by PubChem (NCBI)