Products 310881-39-1

CAS 310881-39-1 is the registry number for 5-Isopropoxypyridin-3-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-propan-2-yloxypyridin-3-ol (CAS 310881-39-1) is a chemical compound with the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. IUPAC name: 5-propan-2-yloxypyridin-3-ol. InChIKey: JSNZQIVDTFNTDR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11NO2
Molecular weight153.18 g/mol
IUPAC name5-propan-2-yloxypyridin-3-ol
InChIKeyJSNZQIVDTFNTDR-UHFFFAOYSA-N
SMILESCC(C)OC1=CN=CC(=C1)O

Computed by PubChem (NCBI)