CAS 31105-14-3 is the registry number for Olmidine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(1,3-benzodioxol-5-yl)-2-hydroxyethanimidamide (CAS 31105-14-3) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)-2-hydroxyethanimidamide. InChIKey: DPOREOOGDLINFI-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)-2-hydroxyethanimidamide |
| InChIKey | DPOREOOGDLINFI-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(C(=N)N)O |
Computed by PubChem (NCBI)