Products 31161-72-5

CAS 31161-72-5 is the registry number for 2-Ethyl-4-phenylbutanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-ethyl-4-phenylbutanoic acid (CAS 31161-72-5) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 2-ethyl-4-phenylbutanoic acid. InChIKey: KWMRHYQFTOZULH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O2
Molecular weight192.25 g/mol
IUPAC name2-ethyl-4-phenylbutanoic acid
InChIKeyKWMRHYQFTOZULH-UHFFFAOYSA-N
SMILESCCC(CCC1=CC=CC=C1)C(=O)O

Computed by PubChem (NCBI)