CAS 312-44-7 appears in our catalog under these names: 2-Amino-2-(4-fluoro-phenyl)-propionic acid, 95%, 2–Amino–2–(4–fluoro–phenyl)–propionic acid, 2-Amino-2-(4-fluoro-phenyl)-propionic acid, 2-Amino-2-(4-fluoro-phenyl)-propionic acid 95%, 2-Amino-2-(4-fluoro-phenyl)propionic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g, 500mg.
2-amino-2-(4-fluorophenyl)propanoic acid (CAS 312-44-7) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: 2-amino-2-(4-fluorophenyl)propanoic acid. InChIKey: ORLSRSJHRJOCNH-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | 2-amino-2-(4-fluorophenyl)propanoic acid |
| InChIKey | ORLSRSJHRJOCNH-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)F)(C(=O)O)N |
Computed by PubChem (NCBI)