Products 3121-70-8
CAS 3121-70-8 appears in our catalog under these names: 1-Naphthyl butyrate, 98%, 1–Naphthyl butyrate, alpha-Naphthyl butyrate, 1-Naphthyl Butyrate, >98.0%(GC), 1-Naphthyl butyrate. Offered by: Combi-blocks, GLPBio, Biosynth, Thermo Scientific (Acros), TCI. Available pack sizes: 1g, 5g, 25g, 250 mg, 100 mg, 50 mg, 500 mg.
Naphthalen-1-yl butanoate (CAS 3121-70-8) is a chemical compound with the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. IUPAC name: naphthalen-1-yl butanoate. InChIKey: XIVJNRXPRQKFRZ-UHFFFAOYSA-N.
| Molecular formula | C14H14O2 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | naphthalen-1-yl butanoate |
| InChIKey | XIVJNRXPRQKFRZ-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OC1=CC=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)