Products 312272-63-2
CAS 312272-63-2 is the registry number for 4-(4-Hydroxy-3-methoxystyryl)-6-(trifluoromethyl)pyrimidin-2(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6-(trifluoromethyl)-1H-pyrimidin-2-one (CAS 312272-63-2) is a chemical compound with the molecular formula C14H11F3N2O3 and a molecular weight of 312.24 g/mol. IUPAC name: 4-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6-(trifluoromethyl)-1H-pyrimidin-2-one. InChIKey: PSVMBJLLCQSXSO-UHFFFAOYSA-N.
| Molecular formula | C14H11F3N2O3 |
|---|---|
| Molecular weight | 312.24 g/mol |
| IUPAC name | 4-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6-(trifluoromethyl)-1H-pyrimidin-2-one |
| InChIKey | PSVMBJLLCQSXSO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=CC2=NC(=O)NC(=C2)C(F)(F)F)O |
Computed by PubChem (NCBI)