CAS 75369-61-8 appears in our catalog under these names: 5-Hydroxy Flunixin, 5-Hydroxy Flunixin (Contain 5% Flunixin), >95% (HPLC), Flunixin-5-hydroxy, 5–hydroxy Flunixin, 5-HYDROXYFLUNIXIN. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, TargetMol, GLPBio. Available pack sizes: on request, 10mg, 1mg, 2,5mg, 500ug, 5mg, 500μg, 0,5mg.
5-hydroxy-2-[2-methyl-3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid (CAS 75369-61-8) is a chemical compound with the molecular formula C14H11F3N2O3 and a molecular weight of 312.24 g/mol. IUPAC name: 5-hydroxy-2-[2-methyl-3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid. InChIKey: JSXNJGKWSWRIGA-UHFFFAOYSA-N.
| Molecular formula | C14H11F3N2O3 |
|---|---|
| Molecular weight | 312.24 g/mol |
| IUPAC name | 5-hydroxy-2-[2-methyl-3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid |
| InChIKey | JSXNJGKWSWRIGA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1NC2=C(C=C(C=N2)O)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)