CAS 875156-74-4 is the registry number for (3,5-Dimethyl-1-[3-(trifluoromethyl)phenyl]-1h-pyrazol-4-yl)(oxo)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxoacetic acid (CAS 875156-74-4) is a chemical compound with the molecular formula C14H11F3N2O3 and a molecular weight of 312.24 g/mol. IUPAC name: 2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxoacetic acid. InChIKey: DIZUBEDMZQHUFF-UHFFFAOYSA-N.
| Molecular formula | C14H11F3N2O3 |
|---|---|
| Molecular weight | 312.24 g/mol |
| IUPAC name | 2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxoacetic acid |
| InChIKey | DIZUBEDMZQHUFF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=CC(=C2)C(F)(F)F)C)C(=O)C(=O)O |
Computed by PubChem (NCBI)