CAS 312310-14-8 appears in our catalog under these names: 5-[(3,5-Dimethyl-1h-pyrazol-1-yl)methyl]-2-furoic acid, 95%, 5-((3,5-Dimethyl-1H-pyrazol-1-yl)methyl)furan-2-carboxylic acid, 95+%, 5-((3,5-Dimethyl-1H-pyrazol-1-yl)methyl)-2-furoic acid, 5-(3,5-Dimethyl-pyrazol-1-ylmethyl)-furan-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylic acid (CAS 312310-14-8) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylic acid. InChIKey: BPVDCRCAORFYHG-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylic acid |
| InChIKey | BPVDCRCAORFYHG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CC2=CC=C(O2)C(=O)O)C |
Computed by PubChem (NCBI)