Products 31251-43-1
CAS 31251-43-1 is the registry number for Loratadine Impurity 44. Offered by: Chemat Brand. Available pack sizes: on request.
15-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one (CAS 31251-43-1) is a chemical compound with the molecular formula C14H10ClNO and a molecular weight of 243.69 g/mol. IUPAC name: 15-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one. InChIKey: OOALQVKYESQRBV-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 15-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
| InChIKey | OOALQVKYESQRBV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C3=C1C=CC=C3Cl)N=CC=C2 |
Computed by PubChem (NCBI)