CAS 312749-73-8 appears in our catalog under these names: 2-([2-(4-Chlorophenoxy)ethyl]thio)-1H-benzimidazole, 95%, CLP–3094, CLP-3094/ 99.84% (existing batch purity), CLP-3094 97%, CLP-3094, 99.92%. Offered by: Combi-blocks, GLPBio, TargetMol, Ambeed, MedChemExpress. Available pack sizes: 5g, 250mg, 1g, 10mg, 10mM (in 1ml dmso), 5mg, 1mg, 25mg.
2-[2-(4-chlorophenoxy)ethylsulfanyl]-1H-benzimidazole (CAS 312749-73-8) is a chemical compound with the molecular formula C15H13ClN2OS and a molecular weight of 304.8 g/mol. IUPAC name: 2-[2-(4-chlorophenoxy)ethylsulfanyl]-1H-benzimidazole. InChIKey: KZEWVENYWPSSOZ-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2OS |
|---|---|
| Molecular weight | 304.8 g/mol |
| IUPAC name | 2-[2-(4-chlorophenoxy)ethylsulfanyl]-1H-benzimidazole |
| InChIKey | KZEWVENYWPSSOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)SCCOC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)