Products 423749-25-1
CAS 423749-25-1 is the registry number for Phenothiazine Analogues/ 98%. Offered by: TargetMol. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
3-amino-1-(2-chlorophenothiazin-10-yl)propan-1-one (CAS 423749-25-1) is a chemical compound with the molecular formula C15H13ClN2OS and a molecular weight of 304.8 g/mol. IUPAC name: 3-amino-1-(2-chlorophenothiazin-10-yl)propan-1-one. InChIKey: SQTAPPOMKRHHLQ-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2OS |
|---|---|
| Molecular weight | 304.8 g/mol |
| IUPAC name | 3-amino-1-(2-chlorophenothiazin-10-yl)propan-1-one |
| InChIKey | SQTAPPOMKRHHLQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3=C(S2)C=CC(=C3)Cl)C(=O)CCN |
Computed by PubChem (NCBI)