CAS 79615-33-1 appears in our catalog under these names: 4-(4-Phenoxyphenyl)-1,3-thiazol-2-amine hydrochloride, 95%, 4-(4-Phenoxyphenyl)-1,3-thiazol-2-amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 5g.
4-(4-phenoxyphenyl)-1,3-thiazol-2-amine;hydrochloride (CAS 79615-33-1) is a chemical compound with the molecular formula C15H13ClN2OS and a molecular weight of 304.8 g/mol. IUPAC name: 4-(4-phenoxyphenyl)-1,3-thiazol-2-amine;hydrochloride. InChIKey: CKIFDWDNHIPOJZ-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2OS |
|---|---|
| Molecular weight | 304.8 g/mol |
| IUPAC name | 4-(4-phenoxyphenyl)-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | CKIFDWDNHIPOJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C3=CSC(=N3)N.Cl |
Computed by PubChem (NCBI)