CAS 312767-04-7 is the registry number for 4′-Ethenyl[1,1′-biphenyl]-4-methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[4-(4-ethenylphenyl)phenyl]methanol (CAS 312767-04-7) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: [4-(4-ethenylphenyl)phenyl]methanol. InChIKey: OTBRRCOWRRZIGE-UHFFFAOYSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | [4-(4-ethenylphenyl)phenyl]methanol |
| InChIKey | OTBRRCOWRRZIGE-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)