CAS 312772-65-9 is the registry number for 3-(5-Methyl-4H-1,2,4-triazol-3-yl)benzonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(5-methyl-1H-1,2,4-triazol-3-yl)benzonitrile (CAS 312772-65-9) is a chemical compound with the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. IUPAC name: 3-(5-methyl-1H-1,2,4-triazol-3-yl)benzonitrile. InChIKey: UVWHAYCHLAHEOI-UHFFFAOYSA-N.
| Molecular formula | C10H8N4 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | 3-(5-methyl-1H-1,2,4-triazol-3-yl)benzonitrile |
| InChIKey | UVWHAYCHLAHEOI-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1)C2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)