CAS 312934-03-5 is the registry number for (S)-5,5',6,6'-Tetrahydroxy-3,3,3',3'-tetramethyl-1,1'-spirobiindane, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5',6,6'-tetrol (CAS 312934-03-5) is a chemical compound with the molecular formula C21H24O4 and a molecular weight of 340.4 g/mol. IUPAC name: 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5',6,6'-tetrol. InChIKey: POFMQEVZKZVAPQ-UHFFFAOYSA-N.
| Molecular formula | C21H24O4 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5',6,6'-tetrol |
| InChIKey | POFMQEVZKZVAPQ-UHFFFAOYSA-N |
| SMILES | CC1(CC2(CC(C3=CC(=C(C=C32)O)O)(C)C)C4=CC(=C(C=C41)O)O)C |
Computed by PubChem (NCBI)