Products 53989-32-5
CAS 53989-32-5 appears in our catalog under these names: 11–nor–9–carboxy Cannabinol, Cannabinol-7-oic acid. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 100μg, Get quote.
1-hydroxy-6,6-dimethyl-3-pentylbenzo[c]chromene-9-carboxylic acid (CAS 53989-32-5) is a chemical compound with the molecular formula C21H24O4 and a molecular weight of 340.4 g/mol. IUPAC name: 1-hydroxy-6,6-dimethyl-3-pentylbenzo[c]chromene-9-carboxylic acid. InChIKey: RUDAUXBQLBAKOW-UHFFFAOYSA-N.
| Molecular formula | C21H24O4 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 1-hydroxy-6,6-dimethyl-3-pentylbenzo[c]chromene-9-carboxylic acid |
| InChIKey | RUDAUXBQLBAKOW-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC(=C2C(=C1)OC(C3=C2C=C(C=C3)C(=O)O)(C)C)O |
Computed by PubChem (NCBI)