Products 72881-08-4
CAS 72881-08-4 appears in our catalog under these names: (±)–Acuminatin, (±)-Acuminatin. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5 mg, 1 mg.
(2S,3S)-2-(3,4-dimethoxyphenyl)-7-methoxy-3-methyl-5-[(E)-prop-1-enyl]-2,3-dihydro-1-benzofuran (CAS 72881-08-4) is a chemical compound with the molecular formula C21H24O4 and a molecular weight of 340.4 g/mol. IUPAC name: (2S,3S)-2-(3,4-dimethoxyphenyl)-7-methoxy-3-methyl-5-[(E)-prop-1-enyl]-2,3-dihydro-1-benzofuran. InChIKey: ITFKWUHXYCXXFF-DTTGGASTSA-N.
| Molecular formula | C21H24O4 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | (2S,3S)-2-(3,4-dimethoxyphenyl)-7-methoxy-3-methyl-5-[(E)-prop-1-enyl]-2,3-dihydro-1-benzofuran |
| InChIKey | ITFKWUHXYCXXFF-DTTGGASTSA-N |
| SMILES | C/C=C/C1=CC2=C(C(=C1)OC)O[C@@H]([C@H]2C)C3=CC(=C(C=C3)OC)OC |
Computed by PubChem (NCBI)