CAS 312941-39-2 is the registry number for 2-Chloro-5,7-dimethylquinolin-8-ol, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-chloro-5,7-dimethylquinolin-8-ol (CAS 312941-39-2) is a chemical compound with the molecular formula C11H10ClNO and a molecular weight of 207.65 g/mol. IUPAC name: 2-chloro-5,7-dimethylquinolin-8-ol. InChIKey: UZHWQMSRJRJPKC-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 2-chloro-5,7-dimethylquinolin-8-ol |
| InChIKey | UZHWQMSRJRJPKC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=C1C=CC(=N2)Cl)O)C |
Computed by PubChem (NCBI)