CAS 313254-94-3 appears in our catalog under these names: MMG-11, MMG-11, 98%, MMG–11, Ethyl 5-(2-oxo-2-(2,3,4-trihydroxyphenyl)ethyl)furan-2-carboxylate, 97%, 97%, MMG-11, 99.24%. Offered by: Chemat Brand, AmBeed, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 2mg, 10mg, 50mg, 25mg, 5mg, 10mM/1mL.
Ethyl 5-[2-oxo-2-(2,3,4-trihydroxyphenyl)ethyl]furan-2-carboxylate (CAS 313254-94-3) is a chemical compound with the molecular formula C15H14O7 and a molecular weight of 306.27 g/mol. IUPAC name: ethyl 5-[2-oxo-2-(2,3,4-trihydroxyphenyl)ethyl]furan-2-carboxylate. InChIKey: IIDUJWIVMGALOG-UHFFFAOYSA-N.
| Molecular formula | C15H14O7 |
|---|---|
| Molecular weight | 306.27 g/mol |
| IUPAC name | ethyl 5-[2-oxo-2-(2,3,4-trihydroxyphenyl)ethyl]furan-2-carboxylate |
| InChIKey | IIDUJWIVMGALOG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(O1)CC(=O)C2=C(C(=C(C=C2)O)O)O |
Computed by PubChem (NCBI)