Products 1623437-86-4
CAS 1623437-86-4 appears in our catalog under these names: Hydramicromelin D, Hydramicromelin D. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
6-[(2R,3S,4S)-3,4-dihydroxy-4-methyl-5-oxooxolan-2-yl]-7-methoxychromen-2-one (CAS 1623437-86-4) is a chemical compound with the molecular formula C15H14O7 and a molecular weight of 306.27 g/mol. IUPAC name: 6-[(2R,3S,4S)-3,4-dihydroxy-4-methyl-5-oxooxolan-2-yl]-7-methoxychromen-2-one. InChIKey: XSUHWPFITUMCFA-IPYPFGDCSA-N.
| Molecular formula | C15H14O7 |
|---|---|
| Molecular weight | 306.27 g/mol |
| IUPAC name | 6-[(2R,3S,4S)-3,4-dihydroxy-4-methyl-5-oxooxolan-2-yl]-7-methoxychromen-2-one |
| InChIKey | XSUHWPFITUMCFA-IPYPFGDCSA-N |
| SMILES | C[C@@]1([C@H]([C@H](OC1=O)C2=C(C=C3C(=C2)C=CC(=O)O3)OC)O)O |
Computed by PubChem (NCBI)