Products 69256-15-1
CAS 69256-15-1 appears in our catalog under these names: (+)-Leucocyanidin, 99.80%, (+)-Leucocyanidin, 98%, 98%. Offered by: MedChemExpress, Chemat. Available pack sizes: 1 mg, 5mg.
(2R,3S,4R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,5,7-tetrol (CAS 69256-15-1) is a chemical compound with the molecular formula C15H14O7 and a molecular weight of 306.27 g/mol. IUPAC name: (2R,3S,4R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,5,7-tetrol. InChIKey: SBZWTSHAFILOTE-QLFBSQMISA-N.
| Molecular formula | C15H14O7 |
|---|---|
| Molecular weight | 306.27 g/mol |
| IUPAC name | (2R,3S,4R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,5,7-tetrol |
| InChIKey | SBZWTSHAFILOTE-QLFBSQMISA-N |
| SMILES | C1=CC(=C(C=C1[C@@H]2[C@H]([C@@H](C3=C(C=C(C=C3O2)O)O)O)O)O)O |
Computed by PubChem (NCBI)