CAS 313350-11-7 is the registry number for Isopropyl 6-chloronicotinate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Propan-2-yl 6-chloropyridine-3-carboxylate (CAS 313350-11-7) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: propan-2-yl 6-chloropyridine-3-carboxylate. InChIKey: ZECYQZQJDTYQHH-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | propan-2-yl 6-chloropyridine-3-carboxylate |
| InChIKey | ZECYQZQJDTYQHH-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CN=C(C=C1)Cl |
Computed by PubChem (NCBI)