Products 313350-11-7

CAS 313350-11-7 is the registry number for Isopropyl 6-chloronicotinate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Propan-2-yl 6-chloropyridine-3-carboxylate (CAS 313350-11-7) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: propan-2-yl 6-chloropyridine-3-carboxylate. InChIKey: ZECYQZQJDTYQHH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO2
Molecular weight199.63 g/mol
IUPAC namepropan-2-yl 6-chloropyridine-3-carboxylate
InChIKeyZECYQZQJDTYQHH-UHFFFAOYSA-N
SMILESCC(C)OC(=O)C1=CN=C(C=C1)Cl

Computed by PubChem (NCBI)