Products 7509-74-2

CAS 7509-74-2 is the registry number for Benzenamine, 4,4′-(phenylethenylidene)bis[N,N-dimethyl-, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-[1-[4-(dimethylamino)phenyl]-2-phenylethenyl]-N,N-dimethylaniline (CAS 7509-74-2) is a chemical compound with the molecular formula C24H26N2 and a molecular weight of 342.5 g/mol. IUPAC name: 4-[1-[4-(dimethylamino)phenyl]-2-phenylethenyl]-N,N-dimethylaniline. InChIKey: HPEFUALZETVWQS-UHFFFAOYSA-N.

Identity
Molecular formulaC24H26N2
Molecular weight342.5 g/mol
IUPAC name4-[1-[4-(dimethylamino)phenyl]-2-phenylethenyl]-N,N-dimethylaniline
InChIKeyHPEFUALZETVWQS-UHFFFAOYSA-N
SMILESCN(C)C1=CC=C(C=C1)C(=CC2=CC=CC=C2)C3=CC=C(C=C3)N(C)C

Computed by PubChem (NCBI)