CAS 7509-74-2 is the registry number for Benzenamine, 4,4′-(phenylethenylidene)bis[N,N-dimethyl-, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-[1-[4-(dimethylamino)phenyl]-2-phenylethenyl]-N,N-dimethylaniline (CAS 7509-74-2) is a chemical compound with the molecular formula C24H26N2 and a molecular weight of 342.5 g/mol. IUPAC name: 4-[1-[4-(dimethylamino)phenyl]-2-phenylethenyl]-N,N-dimethylaniline. InChIKey: HPEFUALZETVWQS-UHFFFAOYSA-N.
| Molecular formula | C24H26N2 |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | 4-[1-[4-(dimethylamino)phenyl]-2-phenylethenyl]-N,N-dimethylaniline |
| InChIKey | HPEFUALZETVWQS-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=CC2=CC=CC=C2)C3=CC=C(C=C3)N(C)C |
Computed by PubChem (NCBI)