CAS 31366-07-1 appears in our catalog under these names: 3,3-Dimethyl-1-phenylbutan-1-one, 95%, 3,3-Dimethylbutyrophenone, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 100mg, 1g.
3,3-dimethyl-1-phenylbutan-1-one (CAS 31366-07-1) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 3,3-dimethyl-1-phenylbutan-1-one. InChIKey: RAGQNMUFPJIWQE-UHFFFAOYSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 3,3-dimethyl-1-phenylbutan-1-one |
| InChIKey | RAGQNMUFPJIWQE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)