CAS 313685-03-9 is the registry number for Ethyl 1-((4-chlorophenyl)sulfonyl)-4-piperidinecarboxylate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
Ethyl 1-(4-chlorophenyl)sulfonylpiperidine-4-carboxylate (CAS 313685-03-9) is a chemical compound with the molecular formula C14H18ClNO4S and a molecular weight of 331.8 g/mol. IUPAC name: ethyl 1-(4-chlorophenyl)sulfonylpiperidine-4-carboxylate. InChIKey: QMZUEYTVCVLRFI-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO4S |
|---|---|
| Molecular weight | 331.8 g/mol |
| IUPAC name | ethyl 1-(4-chlorophenyl)sulfonylpiperidine-4-carboxylate |
| InChIKey | QMZUEYTVCVLRFI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)