CAS 674819-28-4 is the registry number for (1R,4r)-4-((4-chlorobenzenesulfonamido)methyl)cyclohexane-1-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-[[(4-chlorophenyl)sulfonylamino]methyl]cyclohexane-1-carboxylic acid (CAS 674819-28-4) is a chemical compound with the molecular formula C14H18ClNO4S and a molecular weight of 331.8 g/mol. IUPAC name: 4-[[(4-chlorophenyl)sulfonylamino]methyl]cyclohexane-1-carboxylic acid. InChIKey: QSAMXYYSGGMNTJ-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO4S |
|---|---|
| Molecular weight | 331.8 g/mol |
| IUPAC name | 4-[[(4-chlorophenyl)sulfonylamino]methyl]cyclohexane-1-carboxylic acid |
| InChIKey | QSAMXYYSGGMNTJ-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1CNS(=O)(=O)C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)