Products 743451-72-1
CAS 743451-72-1 is the registry number for 2-Chloro-5-(cyclohexyl(methyl)sulfamoyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-chloro-5-[cyclohexyl(methyl)sulfamoyl]benzoic acid (CAS 743451-72-1) is a chemical compound with the molecular formula C14H18ClNO4S and a molecular weight of 331.8 g/mol. IUPAC name: 2-chloro-5-[cyclohexyl(methyl)sulfamoyl]benzoic acid. InChIKey: ADUTVRHCCHVNQG-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO4S |
|---|---|
| Molecular weight | 331.8 g/mol |
| IUPAC name | 2-chloro-5-[cyclohexyl(methyl)sulfamoyl]benzoic acid |
| InChIKey | ADUTVRHCCHVNQG-UHFFFAOYSA-N |
| SMILES | CN(C1CCCCC1)S(=O)(=O)C2=CC(=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)