Products 31384-98-2
CAS 31384-98-2 appears in our catalog under these names: N–Salicyloyltryptamine, N-Salicyloyltryptamine, 96.37%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 10 mg, 5 mg.
2-hydroxy-N-[2-(1H-indol-3-yl)ethyl]benzamide (CAS 31384-98-2) is a chemical compound with the molecular formula C17H16N2O2 and a molecular weight of 280.32 g/mol. IUPAC name: 2-hydroxy-N-[2-(1H-indol-3-yl)ethyl]benzamide. InChIKey: XBPYTDZHCNJRBY-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O2 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | 2-hydroxy-N-[2-(1H-indol-3-yl)ethyl]benzamide |
| InChIKey | XBPYTDZHCNJRBY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=O)C3=CC=CC=C3O |
Computed by PubChem (NCBI)