CAS 3139-86-4 is the registry number for 4-ethenyl-alpha,alpha-diphenyl-Benzenemethanol. Offered by: TRC. Available pack sizes: 1g.
(4-ethenylphenyl)-diphenylmethanol (CAS 3139-86-4) is a chemical compound with the molecular formula C21H18O and a molecular weight of 286.4 g/mol. IUPAC name: (4-ethenylphenyl)-diphenylmethanol. InChIKey: SWWUBPMMAJXOOX-UHFFFAOYSA-N.
| Molecular formula | C21H18O |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | (4-ethenylphenyl)-diphenylmethanol |
| InChIKey | SWWUBPMMAJXOOX-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)