CAS 63665-87-2 is the registry number for 7-Methylindan-4-yl 1-Naphthyl Ketone. Offered by: TRC. Available pack sizes: 2,5g, 250mg.
(7-methyl-2,3-dihydro-1H-inden-4-yl)-naphthalen-1-ylmethanone (CAS 63665-87-2) is a chemical compound with the molecular formula C21H18O and a molecular weight of 286.4 g/mol. IUPAC name: (7-methyl-2,3-dihydro-1H-inden-4-yl)-naphthalen-1-ylmethanone. InChIKey: GZCQYBBVUZYWNO-UHFFFAOYSA-N.
| Molecular formula | C21H18O |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | (7-methyl-2,3-dihydro-1H-inden-4-yl)-naphthalen-1-ylmethanone |
| InChIKey | GZCQYBBVUZYWNO-UHFFFAOYSA-N |
| SMILES | CC1=C2CCCC2=C(C=C1)C(=O)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)