Products 622-21-9
CAS 622-21-9 appears in our catalog under these names: 1,9-Diphenyl-1,3,6,8-nonatetraen-5-one, 98%, Dicinnamalacetone, 1,9-Diphenyl-1,3,6,8-nonatetraen-5-one, 97+% , Dicinnamalacetone, >98.0%(HPLC), 1,9-Diphenylnona-1,3,6,8-tetraen-5-one, 98%, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat. Available pack sizes: 1g, 25g, 5g, 100g, 10g.
(1E,3E,6E,8E)-1,9-diphenylnona-1,3,6,8-tetraen-5-one (CAS 622-21-9) is a chemical compound with the molecular formula C21H18O and a molecular weight of 286.4 g/mol. IUPAC name: (1E,3E,6E,8E)-1,9-diphenylnona-1,3,6,8-tetraen-5-one. InChIKey: RLJALOQFYHCJKG-FVRNMFRHSA-N.
| Molecular formula | C21H18O |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | (1E,3E,6E,8E)-1,9-diphenylnona-1,3,6,8-tetraen-5-one |
| InChIKey | RLJALOQFYHCJKG-FVRNMFRHSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C=C/C(=O)/C=C/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)