CAS 314041-54-8 is the registry number for 6-Methylchromone hydrate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
6-methylchromen-4-one;hydrate (CAS 314041-54-8) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 6-methylchromen-4-one;hydrate. InChIKey: QWIQUUMSUBFRAX-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 6-methylchromen-4-one;hydrate |
| InChIKey | QWIQUUMSUBFRAX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)OC=CC2=O.O |
Computed by PubChem (NCBI)