Products 314084-64-5

CAS 314084-64-5 is the registry number for 2,5-Dibromo-1,3-diethylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2,5-dibromo-1,3-diethylbenzene (CAS 314084-64-5) is a chemical compound with the molecular formula C10H12Br2 and a molecular weight of 292.01 g/mol. IUPAC name: 2,5-dibromo-1,3-diethylbenzene. InChIKey: WNUHBZLYVFZJSK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12Br2
Molecular weight292.01 g/mol
IUPAC name2,5-dibromo-1,3-diethylbenzene
InChIKeyWNUHBZLYVFZJSK-UHFFFAOYSA-N
SMILESCCC1=CC(=CC(=C1Br)CC)Br

Computed by PubChem (NCBI)