Products 314248-25-4
CAS 314248-25-4 is the registry number for N-(2,4-Dimethoxybenzylidene)-4-methylbenzenesulfonamide, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
(NE)-N-[(2,4-dimethoxyphenyl)methylidene]-4-methylbenzenesulfonamide (CAS 314248-25-4) is a chemical compound with the molecular formula C16H17NO4S and a molecular weight of 319.4 g/mol. IUPAC name: (NE)-N-[(2,4-dimethoxyphenyl)methylidene]-4-methylbenzenesulfonamide. InChIKey: ZLGWEWVVSRSMLZ-GZTJUZNOSA-N.
| Molecular formula | C16H17NO4S |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | (NE)-N-[(2,4-dimethoxyphenyl)methylidene]-4-methylbenzenesulfonamide |
| InChIKey | ZLGWEWVVSRSMLZ-GZTJUZNOSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)/N=C/C2=C(C=C(C=C2)OC)OC |
Computed by PubChem (NCBI)