Products 314248-61-8
CAS 314248-61-8 is the registry number for METHYL 2,3-DIAMINO-5-CHLOROBENZOATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2,3-diamino-5-chlorobenzoate (CAS 314248-61-8) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: methyl 2,3-diamino-5-chlorobenzoate. InChIKey: GECVXLCPJGIRBS-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | methyl 2,3-diamino-5-chlorobenzoate |
| InChIKey | GECVXLCPJGIRBS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Cl)N)N |
Computed by PubChem (NCBI)