Products 31456-63-0
CAS 31456-63-0 is the registry number for 9-Hydroxy-o-senecioyl-8,9-dihydrooroselol. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
2-(9-hydroxy-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl 3-methylbut-2-enoate (CAS 31456-63-0) is a chemical compound with the molecular formula C19H20O6 and a molecular weight of 344.4 g/mol. IUPAC name: 2-(9-hydroxy-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl 3-methylbut-2-enoate. InChIKey: MLVGNKLKRAKEBJ-UHFFFAOYSA-N.
| Molecular formula | C19H20O6 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 2-(9-hydroxy-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl 3-methylbut-2-enoate |
| InChIKey | MLVGNKLKRAKEBJ-UHFFFAOYSA-N |
| SMILES | CC(=CC(=O)OC(C)(C)C1C(C2=C(O1)C=CC3=C2OC(=O)C=C3)O)C |
Computed by PubChem (NCBI)