Products 31456-96-9
CAS 31456-96-9 is the registry number for Methyl 2-hydroxy-5-methyl-3-(prop-2-en-1-yl)benzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-hydroxy-5-methyl-3-prop-2-enylbenzoate (CAS 31456-96-9) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: methyl 2-hydroxy-5-methyl-3-prop-2-enylbenzoate. InChIKey: HJRZTEWSFJXJOD-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | methyl 2-hydroxy-5-methyl-3-prop-2-enylbenzoate |
| InChIKey | HJRZTEWSFJXJOD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C(=O)OC)O)CC=C |
Computed by PubChem (NCBI)