CAS 31457-03-1 appears in our catalog under these names: 2-Methyl-2,3-dihydro-1-benzofuran-7-carboxylic acid, 95%, 2-Methyl-2,3-dihydrobenzofuran-7-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 10g, 5g, 1g.
2-methyl-2,3-dihydro-1-benzofuran-7-carboxylic acid (CAS 31457-03-1) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 2-methyl-2,3-dihydro-1-benzofuran-7-carboxylic acid. InChIKey: HWCCVMGTQFWJSS-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 2-methyl-2,3-dihydro-1-benzofuran-7-carboxylic acid |
| InChIKey | HWCCVMGTQFWJSS-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(O1)C(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)