Products 31542-63-9

CAS 31542-63-9 is the registry number for 1,3-Dipropyl-7-methylxanthine. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 10 mg.

Structural formula: {0} (CAS {1})

7-methyl-1,3-dipropylpurine-2,6-dione (CAS 31542-63-9) is a chemical compound with the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. IUPAC name: 7-methyl-1,3-dipropylpurine-2,6-dione. InChIKey: QVAYTZAGDQIWMB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18N4O2
Molecular weight250.30 g/mol
IUPAC name7-methyl-1,3-dipropylpurine-2,6-dione
InChIKeyQVAYTZAGDQIWMB-UHFFFAOYSA-N
SMILESCCCN1C2=C(C(=O)N(C1=O)CCC)N(C=N2)C

Computed by PubChem (NCBI)