CAS 3156-18-1 appears in our catalog under these names: 2-(4-Chlorophenoxymethyl)-1H-1,3-benzodiazole, 95%, 2-(4-Chlorophenoxymethyl)-1H-1,3-benzodiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-[(4-chlorophenoxy)methyl]-1H-benzimidazole (CAS 3156-18-1) is a chemical compound with the molecular formula C14H11ClN2O and a molecular weight of 258.70 g/mol. IUPAC name: 2-[(4-chlorophenoxy)methyl]-1H-benzimidazole. InChIKey: ITCRYYSSWFKZJM-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | 2-[(4-chlorophenoxy)methyl]-1H-benzimidazole |
| InChIKey | ITCRYYSSWFKZJM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)COC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)