Products 315679-65-3

CAS 315679-65-3 is the registry number for 2-Amino-4-(4-(phenylmethyl)phenyl)-3-thiophenecarboxylic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 2-amino-4-(4-benzylphenyl)thiophene-3-carboxylate (CAS 315679-65-3) is a chemical compound with the molecular formula C20H19NO2S and a molecular weight of 337.4 g/mol. IUPAC name: ethyl 2-amino-4-(4-benzylphenyl)thiophene-3-carboxylate. InChIKey: YOSVOBKZGCNEMZ-UHFFFAOYSA-N.

Identity
Molecular formulaC20H19NO2S
Molecular weight337.4 g/mol
IUPAC nameethyl 2-amino-4-(4-benzylphenyl)thiophene-3-carboxylate
InChIKeyYOSVOBKZGCNEMZ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(SC=C1C2=CC=C(C=C2)CC3=CC=CC=C3)N

Computed by PubChem (NCBI)