CAS 853-83-8 is the registry number for N-Benzhydryl-p-toluenesulfonamide. Offered by: Chemat Brand. Available pack sizes: on request.
N-benzhydryl-4-methylbenzenesulfonamide (CAS 853-83-8) is a chemical compound with the molecular formula C20H19NO2S and a molecular weight of 337.4 g/mol. IUPAC name: N-benzhydryl-4-methylbenzenesulfonamide. InChIKey: GRRYGPYATNGHAZ-UHFFFAOYSA-N.
| Molecular formula | C20H19NO2S |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | N-benzhydryl-4-methylbenzenesulfonamide |
| InChIKey | GRRYGPYATNGHAZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)