CAS 4703-20-2 is the registry number for N-Benzyl-4-methyl-N-phenylbenzenesulfonamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
N-benzyl-4-methyl-N-phenylbenzenesulfonamide (CAS 4703-20-2) is a chemical compound with the molecular formula C20H19NO2S and a molecular weight of 337.4 g/mol. IUPAC name: N-benzyl-4-methyl-N-phenylbenzenesulfonamide. InChIKey: MHDGADJMKCLDOM-UHFFFAOYSA-N.
| Molecular formula | C20H19NO2S |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | N-benzyl-4-methyl-N-phenylbenzenesulfonamide |
| InChIKey | MHDGADJMKCLDOM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(CC2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)