CAS 31594-45-3 appears in our catalog under these names: 2–Ethoxy–5–nitropyridine, 2-Ethoxy-5-nitropyridine, 2-Ethoxy-5-nitropyridine, >98.0%(GC), 2-Ethoxy-5-nitropyridine 97%, 2-Ethoxy-5-nitropyridine, 97%, 97%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 50g, 5g, 250g, 500g, 10g.
2-ethoxy-5-nitropyridine (CAS 31594-45-3) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 2-ethoxy-5-nitropyridine. InChIKey: LYDVDLYMQVSLQD-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 2-ethoxy-5-nitropyridine |
| InChIKey | LYDVDLYMQVSLQD-UHFFFAOYSA-N |
| SMILES | CCOC1=NC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)