CAS 316-07-4 appears in our catalog under these names: Opromazine hydrochloride/ 95%, 2-chloro-10-[3-(dimethylamino)propyl]-10H-5lambda4-phenothiazin-5-one hydrochloride, Opromazine (hydrochloride). Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
3-(2-chloro-5-oxophenothiazin-10-yl)-N,N-dimethylpropan-1-amine;hydrochloride (CAS 316-07-4) is a chemical compound with the molecular formula C17H20Cl2N2OS and a molecular weight of 371.3 g/mol. IUPAC name: 3-(2-chloro-5-oxophenothiazin-10-yl)-N,N-dimethylpropan-1-amine;hydrochloride. InChIKey: VWLMLCOTJLYYST-UHFFFAOYSA-N.
| Molecular formula | C17H20Cl2N2OS |
|---|---|
| Molecular weight | 371.3 g/mol |
| IUPAC name | 3-(2-chloro-5-oxophenothiazin-10-yl)-N,N-dimethylpropan-1-amine;hydrochloride |
| InChIKey | VWLMLCOTJLYYST-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN1C2=CC=CC=C2S(=O)C3=C1C=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)